C31H17Cl4N5O2 — CID 136600891
4,5,6,7-tetrachloro-3-[4-[(2-hydroxy-3-methyl-11H-benzo[a]carbazol-1-yl)diazenyl]phenyl]iminoisoindol-1-one (PubChem CID 136600891) has the molecular formula C31H17Cl4N5O2 and a molecular weight of 633.32 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-3-[4-[(2-hydroxy-3-methyl-11H-benzo[a]carbazol-1-yl)diazenyl]phenyl]iminoisoindol-1-one.
| Compound Name | 4,5,6,7-tetrachloro-3-[4-[(2-hydroxy-3-methyl-11H-benzo[a]carbazol-1-yl)diazenyl]phenyl]iminoisoindol-1-one |
|---|---|
| PubChem CID | 136600891 |
| Molecular Formula | C31H17Cl4N5O2 |
| Molecular Weight | 633.32 g/mol |
| Exact Mass | 631.01 |
| IUPAC Name | 4,5,6,7-tetrachloro-3-[4-[(2-hydroxy-3-methyl-11H-benzo[a]carbazol-1-yl)diazenyl]phenyl]iminoisoindol-1-one |
| SMILES | Cc1cc2ccc3c4ccccc4[nH]c3c2c(/N=N/c2ccc(/N=C3\NC(=O)c4c(Cl)c(Cl)c(Cl)c(Cl)c43)cc2)c1O |
| InChI | InChI=1S/C31H17Cl4N5O2/c1-13-12-14-6-11-18-17-4-2-3-5-19(17)37-27(18)20(14)28(29(13)41)40-39-16-9-7-15(8-10-16)36-30-21-22(31(42)38-30)24(33)26(35)25(34)23(21)32/h2-12,37,41H,1H3,(H,36,38,42)/b40-39+ |
| InChIKey | JBMDOQGUFULZIA-XQQUEIPISA-N |
| XLogP | 10.34 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.32 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|