C15H9Cl4N3O2 — CID 135703162
3-(4-amino-3-methoxyphenyl)imino-4,5,6,7-tetrachloroisoindol-1-one (PubChem CID 135703162) has the molecular formula C15H9Cl4N3O2 and a molecular weight of 405.07 g/mol. Its IUPAC name is 3-(4-amino-3-methoxyphenyl)imino-4,5,6,7-tetrachloroisoindol-1-one.
| Compound Name | 3-(4-amino-3-methoxyphenyl)imino-4,5,6,7-tetrachloroisoindol-1-one |
|---|---|
| PubChem CID | 135703162 |
| Molecular Formula | C15H9Cl4N3O2 |
| Molecular Weight | 405.07 g/mol |
| Exact Mass | 402.94 |
| IUPAC Name | 3-(4-amino-3-methoxyphenyl)imino-4,5,6,7-tetrachloroisoindol-1-one |
| SMILES | COc1cc(/N=C2\NC(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c32)ccc1N |
| InChI | InChI=1S/C15H9Cl4N3O2/c1-24-7-4-5(2-3-6(7)20)21-14-8-9(15(23)22-14)11(17)13(19)12(18)10(8)16/h2-4H,20H2,1H3,(H,21,22,23) |
| InChIKey | DRBUZLRBBWYRQX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.07 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|