C9H6ClNO3 — CID 86201786
4-chloro-7-methoxyisoindole-1,3-dione (PubChem CID 86201786) has the molecular formula C9H6ClNO3 and a molecular weight of 211.60 g/mol. Its IUPAC name is 4-chloro-7-methoxyisoindole-1,3-dione.
| Compound Name | 4-chloro-7-methoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 86201786 |
| Molecular Formula | C9H6ClNO3 |
| Molecular Weight | 211.60 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | 4-chloro-7-methoxyisoindole-1,3-dione |
| SMILES | COc1ccc(Cl)c2c1C(=O)NC2=O |
| InChI | InChI=1S/C9H6ClNO3/c1-14-5-3-2-4(10)6-7(5)9(13)11-8(6)12/h2-3H,1H3,(H,11,12,13) |
| InChIKey | WRCYYROHKZOSMQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.60 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|