C19H22N4O3 — CID 88816585
N-acetyl-N-[4-[(4-amino-3-methoxyphenyl)diazenyl]-2,6-dimethylphenyl]acetamide (PubChem CID 88816585) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-acetyl-N-[4-[(4-amino-3-methoxyphenyl)diazenyl]-2,6-dimethylphenyl]acetamide.
| Compound Name | N-acetyl-N-[4-[(4-amino-3-methoxyphenyl)diazenyl]-2,6-dimethylphenyl]acetamide |
|---|---|
| PubChem CID | 88816585 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-acetyl-N-[4-[(4-amino-3-methoxyphenyl)diazenyl]-2,6-dimethylphenyl]acetamide |
| SMILES | COc1cc(/N=N/c2cc(C)c(N(C(C)=O)C(C)=O)c(C)c2)ccc1N |
| InChI | InChI=1S/C19H22N4O3/c1-11-8-16(9-12(2)19(11)23(13(3)24)14(4)25)22-21-15-6-7-17(20)18(10-15)26-5/h6-10H,20H2,1-5H3/b22-21+ |
| InChIKey | VLQJJRDQEJEZOT-QURGRASLSA-N |
| XLogP | 4.21 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|