C18H20N4O2 — CID 88816516
N-acetyl-N-[4-[(4-aminophenyl)diazenyl]-2,6-dimethylphenyl]acetamide (PubChem CID 88816516) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is N-acetyl-N-[4-[(4-aminophenyl)diazenyl]-2,6-dimethylphenyl]acetamide.
| Compound Name | N-acetyl-N-[4-[(4-aminophenyl)diazenyl]-2,6-dimethylphenyl]acetamide |
|---|---|
| PubChem CID | 88816516 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | N-acetyl-N-[4-[(4-aminophenyl)diazenyl]-2,6-dimethylphenyl]acetamide |
| SMILES | CC(=O)N(C(C)=O)c1c(C)cc(/N=N/c2ccc(N)cc2)cc1C |
| InChI | InChI=1S/C18H20N4O2/c1-11-9-17(21-20-16-7-5-15(19)6-8-16)10-12(2)18(11)22(13(3)23)14(4)24/h5-10H,19H2,1-4H3/b21-20+ |
| InChIKey | CTMVNPSTZCQFJE-QZQOTICOSA-N |
| XLogP | 4.20 |
| TPSA | 88.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|