C12H9Cl2N3O3S — CID 134929889
4-[(4-aminophenyl)diazenyl]-2,6-dichlorobenzenesulfonic acid (PubChem CID 134929889) has the molecular formula C12H9Cl2N3O3S and a molecular weight of 346.20 g/mol. Its IUPAC name is 4-[(4-aminophenyl)diazenyl]-2,6-dichlorobenzenesulfonic acid.
| Compound Name | 4-[(4-aminophenyl)diazenyl]-2,6-dichlorobenzenesulfonic acid |
|---|---|
| PubChem CID | 134929889 |
| Molecular Formula | C12H9Cl2N3O3S |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 344.97 |
| IUPAC Name | 4-[(4-aminophenyl)diazenyl]-2,6-dichlorobenzenesulfonic acid |
| SMILES | Nc1ccc(/N=N/c2cc(Cl)c(S(=O)(=O)O)c(Cl)c2)cc1 |
| InChI | InChI=1S/C12H9Cl2N3O3S/c13-10-5-9(6-11(14)12(10)21(18,19)20)17-16-8-3-1-7(15)2-4-8/h1-6H,15H2,(H,18,19,20)/b17-16+ |
| InChIKey | RLTRJMFRBXUPJV-WUKNDPDISA-N |
| XLogP | 4.24 |
| TPSA | 105.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|