C26H20N5NaO13S3 — CID 91666501
sodium;4-[(4-aminophenyl)diazenyl]benzenesulfonate;5-nitro-2-[(E)-2-(4-nitro-2-sulfophenyl)ethenyl]benzenesulfonic acid (PubChem CID 91666501) has the molecular formula C26H20N5NaO13S3 and a molecular weight of 729.66 g/mol. Its IUPAC name is sodium;4-[(4-aminophenyl)diazenyl]benzenesulfonate;5-nitro-2-[(E)-2-(4-nitro-2-sulfophenyl)ethenyl]benzenesulfonic acid.
| Compound Name | sodium;4-[(4-aminophenyl)diazenyl]benzenesulfonate;5-nitro-2-[(E)-2-(4-nitro-2-sulfophenyl)ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 91666501 |
| Molecular Formula | C26H20N5NaO13S3 |
| Molecular Weight | 729.66 g/mol |
| Exact Mass | 729.01 |
| IUPAC Name | sodium;4-[(4-aminophenyl)diazenyl]benzenesulfonate;5-nitro-2-[(E)-2-(4-nitro-2-sulfophenyl)ethenyl]benzenesulfonic acid |
| SMILES | Nc1ccc(/N=N/c2ccc(S(=O)(=O)[O-])cc2)cc1.O=[N+]([O-])c1ccc(/C=C/c2ccc([N+](=O)[O-])cc2S(=O)(=O)O)c(S(=O)(=O)O)c1.[Na+] |
| InChI | InChI=1S/C14H10N2O10S2.C12H11N3O3S.Na/c17-15(18)11-5-3-9(13(7-11)27(21,22)23)1-2-10-4-6-12(16(19)20)8-14(10)28(24,25)26;13-9-1-3-10(4-2-9)14-15-11-5-7-12(8-6-11)19(16,17)18;/h1-8H,(H,21,22,23)(H,24,25,26);1-8H,13H2,(H,16,17,18);/q;;+1/p-1/b2-1+;15-14+; |
| InChIKey | KALJHYFMFDGKEP-GDTJTBKMSA-M |
| XLogP | 1.76 |
| TPSA | 302.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.66 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|