C26H19N5O12S3 — CID 102269311
2-[(E)-2-(4-nitro-2-sulfophenyl)ethenyl]-5-[4-[[4-(oxadiaziridin-2-yloxysulfonyl)phenyl]diazenyl]phenyl]benzenesulfonic acid (PubChem CID 102269311) has the molecular formula C26H19N5O12S3 and a molecular weight of 689.66 g/mol. Its IUPAC name is 2-[(E)-2-(4-nitro-2-sulfophenyl)ethenyl]-5-[4-[[4-(oxadiaziridin-2-yloxysulfonyl)phenyl]diazenyl]phenyl]benzenesulfonic acid.
| Compound Name | 2-[(E)-2-(4-nitro-2-sulfophenyl)ethenyl]-5-[4-[[4-(oxadiaziridin-2-yloxysulfonyl)phenyl]diazenyl]phenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 102269311 |
| Molecular Formula | C26H19N5O12S3 |
| Molecular Weight | 689.66 g/mol |
| Exact Mass | 689.02 |
| IUPAC Name | 2-[(E)-2-(4-nitro-2-sulfophenyl)ethenyl]-5-[4-[[4-(oxadiaziridin-2-yloxysulfonyl)phenyl]diazenyl]phenyl]benzenesulfonic acid |
| SMILES | O=[N+]([O-])c1ccc(/C=C/c2ccc(-c3ccc(/N=N/c4ccc(S(=O)(=O)On5[nH]o5)cc4)cc3)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C26H19N5O12S3/c32-30(33)23-12-7-19(26(16-23)45(37,38)39)2-1-18-3-4-20(15-25(18)44(34,35)36)17-5-8-21(9-6-17)27-28-22-10-13-24(14-11-22)46(40,41)43-31-29-42-31/h1-16,29H,(H,34,35,36)(H,37,38,39)/b2-1+,28-27+ |
| InChIKey | RETLGKUVQNOGOO-GNTFNLSCSA-N |
| XLogP | 4.88 |
| TPSA | 253.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.66 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|