C14H8N2O10S2-2 — CID 4216510
5-nitro-2-[2-(4-nitro-2-sulfonatophenyl)ethenyl]benzenesulfonate (PubChem CID 4216510) has the molecular formula C14H8N2O10S2-2 and a molecular weight of 428.36 g/mol. Its IUPAC name is 5-nitro-2-[2-(4-nitro-2-sulfonatophenyl)ethenyl]benzenesulfonate.
| Compound Name | 5-nitro-2-[2-(4-nitro-2-sulfonatophenyl)ethenyl]benzenesulfonate |
|---|---|
| PubChem CID | 4216510 |
| Molecular Formula | C14H8N2O10S2-2 |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 427.96 |
| IUPAC Name | 5-nitro-2-[2-(4-nitro-2-sulfonatophenyl)ethenyl]benzenesulfonate |
| SMILES | O=[N+]([O-])c1ccc(C=Cc2ccc([N+](=O)[O-])cc2S(=O)(=O)[O-])c(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C14H10N2O10S2/c17-15(18)11-5-3-9(13(7-11)27(21,22)23)1-2-10-4-6-12(16(19)20)8-14(10)28(24,25)26/h1-8H,(H,21,22,23)(H,24,25,26)/p-2 |
| InChIKey | UETHPMGVZHBAFB-UHFFFAOYSA-L |
| XLogP | 1.48 |
| TPSA | 200.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|