C26H24N4O10S2 — CID 2749429
bis(1-methylpyridin-1-ium);5-nitro-2-[2-(4-nitro-2-sulfonatophenyl)ethenyl]benzenesulfonate (PubChem CID 2749429) has the molecular formula C26H24N4O10S2 and a molecular weight of 616.63 g/mol. Its IUPAC name is bis(1-methylpyridin-1-ium);5-nitro-2-[2-(4-nitro-2-sulfonatophenyl)ethenyl]benzenesulfonate.
| Compound Name | bis(1-methylpyridin-1-ium);5-nitro-2-[2-(4-nitro-2-sulfonatophenyl)ethenyl]benzenesulfonate |
|---|---|
| PubChem CID | 2749429 |
| Molecular Formula | C26H24N4O10S2 |
| Molecular Weight | 616.63 g/mol |
| Exact Mass | 616.09 |
| IUPAC Name | bis(1-methylpyridin-1-ium);5-nitro-2-[2-(4-nitro-2-sulfonatophenyl)ethenyl]benzenesulfonate |
| SMILES | C[n+]1ccccc1.C[n+]1ccccc1.O=[N+]([O-])c1ccc(C=Cc2ccc([N+](=O)[O-])cc2S(=O)(=O)[O-])c(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C14H10N2O10S2.2C6H8N/c17-15(18)11-5-3-9(13(7-11)27(21,22)23)1-2-10-4-6-12(16(19)20)8-14(10)28(24,25)26;2*1-7-5-3-2-4-6-7/h1-8H,(H,21,22,23)(H,24,25,26);2*2-6H,1H3/q;2*+1/p-2 |
| InChIKey | SFPXALROPCGFJH-UHFFFAOYSA-L |
| XLogP | 2.50 |
| TPSA | 208.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.63 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|