C20H15N3O10S2 — CID 6508793
1-methylpyridin-1-ium;5-nitro-2-[(Z)-(6-nitro-1,1-dioxo-2,1lambda6-benzoxathiol-3-ylidene)methyl]benzenesulfonate (PubChem CID 6508793) has the molecular formula C20H15N3O10S2 and a molecular weight of 521.49 g/mol. Its IUPAC name is 1-methylpyridin-1-ium;5-nitro-2-[(Z)-(6-nitro-1,1-dioxo-2,1lambda6-benzoxathiol-3-ylidene)methyl]benzenesulfonate.
| Compound Name | 1-methylpyridin-1-ium;5-nitro-2-[(Z)-(6-nitro-1,1-dioxo-2,1lambda6-benzoxathiol-3-ylidene)methyl]benzenesulfonate |
|---|---|
| PubChem CID | 6508793 |
| Molecular Formula | C20H15N3O10S2 |
| Molecular Weight | 521.49 g/mol |
| Exact Mass | 521.02 |
| IUPAC Name | 1-methylpyridin-1-ium;5-nitro-2-[(Z)-(6-nitro-1,1-dioxo-2,1lambda6-benzoxathiol-3-ylidene)methyl]benzenesulfonate |
| SMILES | C[n+]1ccccc1.O=[N+]([O-])c1ccc(/C=C2\OS(=O)(=O)c3cc([N+](=O)[O-])ccc32)c(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C14H8N2O10S2.C6H8N/c17-15(18)9-2-1-8(13(6-9)27(21,22)23)5-12-11-4-3-10(16(19)20)7-14(11)28(24,25)26-12;1-7-5-3-2-4-6-7/h1-7H,(H,21,22,23);2-6H,1H3/q;+1/p-1/b12-5-; |
| InChIKey | XWUVYUOBNBZNHW-UHPXVVQNSA-M |
| XLogP | 2.14 |
| TPSA | 190.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.49 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|