C14H6BrN2O10S2- — CID 3905861
2-[bromo-(6-nitro-1,1-dioxo-2,1λ6-benzoxathiol-3-ylidene)methyl]-5-nitrobenzenesulfonate (PubChem CID 3905861) has the molecular formula C14H6BrN2O10S2- and a molecular weight of 506.24 g/mol. Its IUPAC name is 2-[bromo-(6-nitro-1,1-dioxo-2,1λ6-benzoxathiol-3-ylidene)methyl]-5-nitrobenzenesulfonate.
| Compound Name | 2-[bromo-(6-nitro-1,1-dioxo-2,1λ6-benzoxathiol-3-ylidene)methyl]-5-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 3905861 |
| Molecular Formula | C14H6BrN2O10S2- |
| Molecular Weight | 506.24 g/mol |
| Exact Mass | 504.87 |
| IUPAC Name | 2-[bromo-(6-nitro-1,1-dioxo-2,1λ6-benzoxathiol-3-ylidene)methyl]-5-nitrobenzenesulfonate |
| SMILES | O=[N+]([O-])c1ccc(C(Br)=C2OS(=O)(=O)c3cc([N+](=O)[O-])ccc32)c(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C14H7BrN2O10S2/c15-13(9-3-1-7(16(18)19)5-11(9)28(22,23)24)14-10-4-2-8(17(20)21)6-12(10)29(25,26)27-14/h1-6H,(H,22,23,24)/p-1 |
| InChIKey | PJVKJXLMEORLTF-UHFFFAOYSA-M |
| XLogP | 2.35 |
| TPSA | 186.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|