C7H7N3O5S — CID 110209394
azanium 6-nitro-1,1-dioxo-1,2-benzothiazol-3-olate (PubChem CID 110209394) has the molecular formula C7H7N3O5S and a molecular weight of 245.22 g/mol. Its IUPAC name is azanium 6-nitro-1,1-dioxo-1,2-benzothiazol-3-olate.
| Compound Name | azanium 6-nitro-1,1-dioxo-1,2-benzothiazol-3-olate |
|---|---|
| PubChem CID | 110209394 |
| Molecular Formula | C7H7N3O5S |
| Molecular Weight | 245.22 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | azanium 6-nitro-1,1-dioxo-1,2-benzothiazol-3-olate |
| SMILES | O=[N+]([O-])c1ccc2c(c1)S(=O)(=O)N=C2[O-].[NH4+] |
| InChI | InChI=1S/C7H4N2O5S.H3N/c10-7-5-2-1-4(9(11)12)3-6(5)15(13,14)8-7;/h1-3H,(H,8,10);1H3 |
| InChIKey | ANKKCASFXGTTPZ-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.22 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|