C7H4NNaO3S — CID 23675258
sodium 1,1-dioxo-1,2-benzothiazol-3-olate (PubChem CID 23675258) has the molecular formula C7H4NNaO3S and a molecular weight of 205.17 g/mol. Its IUPAC name is sodium 1,1-dioxo-1,2-benzothiazol-3-olate.
| Compound Name | sodium 1,1-dioxo-1,2-benzothiazol-3-olate |
|---|---|
| PubChem CID | 23675258 |
| Molecular Formula | C7H4NNaO3S |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 204.98 |
| IUPAC Name | sodium 1,1-dioxo-1,2-benzothiazol-3-olate |
| SMILES | O=S1(=O)N=C([O-])c2ccccc21.[Na+] |
| InChI | InChI=1S/C7H5NO3S.Na/c9-7-5-3-1-2-4-6(5)12(10,11)8-7;/h1-4H,(H,8,9);/q;+1/p-1 |
| InChIKey | WINXNKPZLFISPD-UHFFFAOYSA-M |
| XLogP | -3.50 |
| TPSA | 69.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | -3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |