C13H13N3O2S — CID 79107428
N-(2,5-dimethylpyrrol-1-yl)-1,1-dioxo-1,2-benzothiazol-3-amine (PubChem CID 79107428) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is N-(2,5-dimethylpyrrol-1-yl)-1,1-dioxo-1,2-benzothiazol-3-amine.
| Compound Name | N-(2,5-dimethylpyrrol-1-yl)-1,1-dioxo-1,2-benzothiazol-3-amine |
|---|---|
| PubChem CID | 79107428 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | N-(2,5-dimethylpyrrol-1-yl)-1,1-dioxo-1,2-benzothiazol-3-amine |
| SMILES | Cc1ccc(C)n1NC1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C13H13N3O2S/c1-9-7-8-10(2)16(9)14-13-11-5-3-4-6-12(11)19(17,18)15-13/h3-8H,1-2H3,(H,14,15) |
| InChIKey | GMTBOTSNYXTYBS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 63.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |