C14H9F3N2O2S — CID 716643
1,1-dioxo-N-[2-(trifluoromethyl)phenyl]-1,2-benzothiazol-3-amine (PubChem CID 716643) has the molecular formula C14H9F3N2O2S and a molecular weight of 326.30 g/mol. Its IUPAC name is 1,1-dioxo-N-[2-(trifluoromethyl)phenyl]-1,2-benzothiazol-3-amine.
| Compound Name | 1,1-dioxo-N-[2-(trifluoromethyl)phenyl]-1,2-benzothiazol-3-amine |
|---|---|
| PubChem CID | 716643 |
| Molecular Formula | C14H9F3N2O2S |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 1,1-dioxo-N-[2-(trifluoromethyl)phenyl]-1,2-benzothiazol-3-amine |
| SMILES | O=S1(=O)N=C(Nc2ccccc2C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C14H9F3N2O2S/c15-14(16,17)10-6-2-3-7-11(10)18-13-9-5-1-4-8-12(9)22(20,21)19-13/h1-8H,(H,18,19) |
| InChIKey | OGHAQXJGIOLYBG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |