C13H8F2N2O2S — CID 171344810
N-(2,5-difluorophenyl)-1,1-dioxo-1,2-benzothiazol-3-amine (PubChem CID 171344810) has the molecular formula C13H8F2N2O2S and a molecular weight of 294.28 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-1,1-dioxo-1,2-benzothiazol-3-amine.
| Compound Name | N-(2,5-difluorophenyl)-1,1-dioxo-1,2-benzothiazol-3-amine |
|---|---|
| PubChem CID | 171344810 |
| Molecular Formula | C13H8F2N2O2S |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | N-(2,5-difluorophenyl)-1,1-dioxo-1,2-benzothiazol-3-amine |
| SMILES | O=S1(=O)N=C(Nc2cc(F)ccc2F)c2ccccc21 |
| InChI | InChI=1S/C13H8F2N2O2S/c14-8-5-6-10(15)11(7-8)16-13-9-3-1-2-4-12(9)20(18,19)17-13/h1-7H,(H,16,17) |
| InChIKey | LCYFUYZHUPYZBQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |