C21H16N2O4S — CID 1007502
[2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 4-methylbenzoate (PubChem CID 1007502) has the molecular formula C21H16N2O4S and a molecular weight of 392.44 g/mol. Its IUPAC name is [2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 4-methylbenzoate.
| Compound Name | [2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 1007502 |
| Molecular Formula | C21H16N2O4S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | [2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccccc2NC2=NS(=O)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C21H16N2O4S/c1-14-10-12-15(13-11-14)21(24)27-18-8-4-3-7-17(18)22-20-16-6-2-5-9-19(16)28(25,26)23-20/h2-13H,1H3,(H,22,23) |
| InChIKey | KGTJLPPHSKXBLH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|