C25H25ClN3O4S- — CID 21214643
[2-(diethylaminomethyl)-4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] benzoate chloride (PubChem CID 21214643) has the molecular formula C25H25ClN3O4S- and a molecular weight of 499.01 g/mol. Its IUPAC name is [2-(diethylaminomethyl)-4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] benzoate chloride.
| Compound Name | [2-(diethylaminomethyl)-4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] benzoate chloride |
|---|---|
| PubChem CID | 21214643 |
| Molecular Formula | C25H25ClN3O4S- |
| Molecular Weight | 499.01 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | [2-(diethylaminomethyl)-4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] benzoate chloride |
| SMILES | CCN(CC)Cc1cc(NC2=NS(=O)(=O)c3ccccc32)ccc1OC(=O)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C25H25N3O4S.ClH/c1-3-28(4-2)17-19-16-20(14-15-22(19)32-25(29)18-10-6-5-7-11-18)26-24-21-12-8-9-13-23(21)33(30,31)27-24;/h5-16H,3-4,17H2,1-2H3,(H,26,27);1H/p-1 |
| InChIKey | ULVZYTVDOSIEEZ-UHFFFAOYSA-M |
| XLogP | 1.31 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.01 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|