C25H25ClN4O6S — CID 17386130
[2-(diethylaminomethyl)-4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 3-nitrobenzoate;hydrochloride (PubChem CID 17386130) has the molecular formula C25H25ClN4O6S and a molecular weight of 545.02 g/mol. Its IUPAC name is [2-(diethylaminomethyl)-4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 3-nitrobenzoate;hydrochloride.
| Compound Name | [2-(diethylaminomethyl)-4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 3-nitrobenzoate;hydrochloride |
|---|---|
| PubChem CID | 17386130 |
| Molecular Formula | C25H25ClN4O6S |
| Molecular Weight | 545.02 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | [2-(diethylaminomethyl)-4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 3-nitrobenzoate;hydrochloride |
| SMILES | CCN(CC)Cc1cc(NC2=NS(=O)(=O)c3ccccc32)ccc1OC(=O)c1cccc([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C25H24N4O6S.ClH/c1-3-28(4-2)16-18-14-19(26-24-21-10-5-6-11-23(21)36(33,34)27-24)12-13-22(18)35-25(30)17-8-7-9-20(15-17)29(31)32;/h5-15H,3-4,16H2,1-2H3,(H,26,27);1H |
| InChIKey | NVMYMKHUFUYTRS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 131.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.02 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|