C26H15N3O6 — CID 3507317
[1-[(1,3-dioxoisoindol-2-yl)iminomethyl]naphthalen-2-yl] 3-nitrobenzoate (PubChem CID 3507317) has the molecular formula C26H15N3O6 and a molecular weight of 465.42 g/mol. Its IUPAC name is [1-[(1,3-dioxoisoindol-2-yl)iminomethyl]naphthalen-2-yl] 3-nitrobenzoate.
| Compound Name | [1-[(1,3-dioxoisoindol-2-yl)iminomethyl]naphthalen-2-yl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 3507317 |
| Molecular Formula | C26H15N3O6 |
| Molecular Weight | 465.42 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | [1-[(1,3-dioxoisoindol-2-yl)iminomethyl]naphthalen-2-yl] 3-nitrobenzoate |
| SMILES | O=C(Oc1ccc2ccccc2c1C=NN1C(=O)c2ccccc2C1=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H15N3O6/c30-24-20-10-3-4-11-21(20)25(31)28(24)27-15-22-19-9-2-1-6-16(19)12-13-23(22)35-26(32)17-7-5-8-18(14-17)29(33)34/h1-15H |
| InChIKey | ZDHDGEVPFQJIAE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 119.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|