C25H16N4O4S — CID 6260718
[1-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]naphthalen-2-yl] 3-nitrobenzoate (PubChem CID 6260718) has the molecular formula C25H16N4O4S and a molecular weight of 468.49 g/mol. Its IUPAC name is [1-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]naphthalen-2-yl] 3-nitrobenzoate.
| Compound Name | [1-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]naphthalen-2-yl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 6260718 |
| Molecular Formula | C25H16N4O4S |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | [1-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]naphthalen-2-yl] 3-nitrobenzoate |
| SMILES | O=C(Oc1ccc2ccccc2c1/C=N\Nc1nc2ccccc2s1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H16N4O4S/c30-24(17-7-5-8-18(14-17)29(31)32)33-22-13-12-16-6-1-2-9-19(16)20(22)15-26-28-25-27-21-10-3-4-11-23(21)34-25/h1-15H,(H,27,28)/b26-15- |
| InChIKey | CGIHJUFKQUDKFM-YSMPRRRNSA-N |
| XLogP | 6.02 |
| TPSA | 106.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|