C29H20N4O5S2 — CID 2424474
[4-[[[4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzoyl]hydrazinylidene]methyl]phenyl] 3-nitrobenzoate (PubChem CID 2424474) has the molecular formula C29H20N4O5S2 and a molecular weight of 568.64 g/mol. Its IUPAC name is [4-[[[4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzoyl]hydrazinylidene]methyl]phenyl] 3-nitrobenzoate.
| Compound Name | [4-[[[4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzoyl]hydrazinylidene]methyl]phenyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 2424474 |
| Molecular Formula | C29H20N4O5S2 |
| Molecular Weight | 568.64 g/mol |
| Exact Mass | 568.09 |
| IUPAC Name | [4-[[[4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzoyl]hydrazinylidene]methyl]phenyl] 3-nitrobenzoate |
| SMILES | O=C(NN=Cc1ccc(OC(=O)c2cccc([N+](=O)[O-])c2)cc1)c1ccc(CSc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C29H20N4O5S2/c34-27(21-12-8-20(9-13-21)18-39-29-31-25-6-1-2-7-26(25)40-29)32-30-17-19-10-14-24(15-11-19)38-28(35)22-4-3-5-23(16-22)33(36)37/h1-17H,18H2,(H,32,34) |
| InChIKey | DLOSYHUAIHSMDA-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 123.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.64 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|