C23H18BrN3O3S2 — CID 2359364
4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]benzamide (PubChem CID 2359364) has the molecular formula C23H18BrN3O3S2 and a molecular weight of 528.45 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 2359364 |
| Molecular Formula | C23H18BrN3O3S2 |
| Molecular Weight | 528.45 g/mol |
| Exact Mass | 527.00 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1cc(C=NNC(=O)c2ccc(CSc3nc4ccccc4s3)cc2)cc(Br)c1O |
| InChI | InChI=1S/C23H18BrN3O3S2/c1-30-19-11-15(10-17(24)21(19)28)12-25-27-22(29)16-8-6-14(7-9-16)13-31-23-26-18-4-2-3-5-20(18)32-23/h2-12,28H,13H2,1H3,(H,27,29) |
| InChIKey | JRWVOXWKPQAYDC-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.45 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|