C23H18FN3O2S2 — CID 6873026
N-[(E)-[3-(1,3-benzothiazol-2-ylsulfanylmethyl)-4-methoxyphenyl]methylideneamino]-4-fluorobenzamide (PubChem CID 6873026) has the molecular formula C23H18FN3O2S2 and a molecular weight of 451.55 g/mol. Its IUPAC name is N-[(E)-[3-(1,3-benzothiazol-2-ylsulfanylmethyl)-4-methoxyphenyl]methylideneamino]-4-fluorobenzamide.
| Compound Name | N-[(E)-[3-(1,3-benzothiazol-2-ylsulfanylmethyl)-4-methoxyphenyl]methylideneamino]-4-fluorobenzamide |
|---|---|
| PubChem CID | 6873026 |
| Molecular Formula | C23H18FN3O2S2 |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | N-[(E)-[3-(1,3-benzothiazol-2-ylsulfanylmethyl)-4-methoxyphenyl]methylideneamino]-4-fluorobenzamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2ccc(F)cc2)cc1CSc1nc2ccccc2s1 |
| InChI | InChI=1S/C23H18FN3O2S2/c1-29-20-11-6-15(13-25-27-22(28)16-7-9-18(24)10-8-16)12-17(20)14-30-23-26-19-4-2-3-5-21(19)31-23/h2-13H,14H2,1H3,(H,27,28)/b25-13+ |
| InChIKey | YPLFPYCWLWZXPU-DHRITJCHSA-N |
| XLogP | 5.50 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|