C30H23FN4O4S — CID 45076121
N-[4-[[(Z)-[3-(1,3-benzoxazol-2-ylsulfanylmethyl)-4-methoxyphenyl]methylideneamino]carbamoyl]phenyl]-2-fluorobenzamide (PubChem CID 45076121) has the molecular formula C30H23FN4O4S and a molecular weight of 554.60 g/mol. Its IUPAC name is N-[4-[[(Z)-[3-(1,3-benzoxazol-2-ylsulfanylmethyl)-4-methoxyphenyl]methylideneamino]carbamoyl]phenyl]-2-fluorobenzamide.
| Compound Name | N-[4-[[(Z)-[3-(1,3-benzoxazol-2-ylsulfanylmethyl)-4-methoxyphenyl]methylideneamino]carbamoyl]phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 45076121 |
| Molecular Formula | C30H23FN4O4S |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.14 |
| IUPAC Name | N-[4-[[(Z)-[3-(1,3-benzoxazol-2-ylsulfanylmethyl)-4-methoxyphenyl]methylideneamino]carbamoyl]phenyl]-2-fluorobenzamide |
| SMILES | COc1ccc(/C=N\NC(=O)c2ccc(NC(=O)c3ccccc3F)cc2)cc1CSc1nc2ccccc2o1 |
| InChI | InChI=1S/C30H23FN4O4S/c1-38-26-15-10-19(16-21(26)18-40-30-34-25-8-4-5-9-27(25)39-30)17-32-35-28(36)20-11-13-22(14-12-20)33-29(37)23-6-2-3-7-24(23)31/h2-17H,18H2,1H3,(H,33,37)(H,35,36)/b32-17- |
| InChIKey | CTYLIJANSDEJQP-KYHGBAKBSA-N |
| XLogP | 6.28 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|