C24H18FN3O5S — CID 1001796
[4-[[[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-fluorobenzoate (PubChem CID 1001796) has the molecular formula C24H18FN3O5S and a molecular weight of 479.49 g/mol. Its IUPAC name is [4-[[[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-fluorobenzoate.
| Compound Name | [4-[[[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-fluorobenzoate |
|---|---|
| PubChem CID | 1001796 |
| Molecular Formula | C24H18FN3O5S |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | [4-[[[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-fluorobenzoate |
| SMILES | COc1cc(C=NNC(=O)CSc2nc3ccccc3o2)ccc1OC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C24H18FN3O5S/c1-31-21-11-15(9-10-20(21)32-23(30)16-5-4-6-17(25)12-16)13-26-28-22(29)14-34-24-27-18-7-2-3-8-19(18)33-24/h2-13H,14H2,1H3,(H,28,29) |
| InChIKey | PVUQVEPJWMXCJM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|