C25H23FN2O6 — CID 5447050
[4-[(Z)-[[2-(3,4-dimethoxyphenyl)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-fluorobenzoate (PubChem CID 5447050) has the molecular formula C25H23FN2O6 and a molecular weight of 466.47 g/mol. Its IUPAC name is [4-[(Z)-[[2-(3,4-dimethoxyphenyl)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-fluorobenzoate.
| Compound Name | [4-[(Z)-[[2-(3,4-dimethoxyphenyl)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-fluorobenzoate |
|---|---|
| PubChem CID | 5447050 |
| Molecular Formula | C25H23FN2O6 |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | [4-[(Z)-[[2-(3,4-dimethoxyphenyl)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-fluorobenzoate |
| SMILES | COc1ccc(CC(=O)N/N=C\c2ccc(OC(=O)c3cccc(F)c3)c(OC)c2)cc1OC |
| InChI | InChI=1S/C25H23FN2O6/c1-31-20-9-7-16(11-22(20)32-2)13-24(29)28-27-15-17-8-10-21(23(12-17)33-3)34-25(30)18-5-4-6-19(26)14-18/h4-12,14-15H,13H2,1-3H3,(H,28,29)/b27-15- |
| InChIKey | GUULYWHKOJZYAT-DICXZTSXSA-N |
| XLogP | 3.76 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|