C29H23FN2O5 — CID 5206260
[4-[[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]-2-methoxyphenyl] 3-fluorobenzoate (PubChem CID 5206260) has the molecular formula C29H23FN2O5 and a molecular weight of 498.51 g/mol. Its IUPAC name is [4-[[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]-2-methoxyphenyl] 3-fluorobenzoate.
| Compound Name | [4-[[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]-2-methoxyphenyl] 3-fluorobenzoate |
|---|---|
| PubChem CID | 5206260 |
| Molecular Formula | C29H23FN2O5 |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | [4-[[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]-2-methoxyphenyl] 3-fluorobenzoate |
| SMILES | COc1cc(C=NNC(=O)C(O)(c2ccccc2)c2ccccc2)ccc1OC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C29H23FN2O5/c1-36-26-17-20(15-16-25(26)37-27(33)21-9-8-14-24(30)18-21)19-31-32-28(34)29(35,22-10-4-2-5-11-22)23-12-6-3-7-13-23/h2-19,35H,1H3,(H,32,34) |
| InChIKey | WDQYZHARZGVDJY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|