C25H20N4OS2 — CID 135576695
4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]benzamide (PubChem CID 135576695) has the molecular formula C25H20N4OS2 and a molecular weight of 456.60 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]benzamide.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 135576695 |
| Molecular Formula | C25H20N4OS2 |
| Molecular Weight | 456.60 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]benzamide |
| SMILES | Cc1[nH]c2ccccc2c1/C=N/NC(=O)c1ccc(CSc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C25H20N4OS2/c1-16-20(19-6-2-3-7-21(19)27-16)14-26-29-24(30)18-12-10-17(11-13-18)15-31-25-28-22-8-4-5-9-23(22)32-25/h2-14,27H,15H2,1H3,(H,29,30)/b26-14+ |
| InChIKey | BKEMBDVRYFSFFU-VULFUBBASA-N |
| XLogP | 6.14 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.60 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|