C22H16N4O3S2 — CID 42991308
4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N-[(E)-(2-nitrophenyl)methylideneamino]benzamide (PubChem CID 42991308) has the molecular formula C22H16N4O3S2 and a molecular weight of 448.53 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N-[(E)-(2-nitrophenyl)methylideneamino]benzamide.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N-[(E)-(2-nitrophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 42991308 |
| Molecular Formula | C22H16N4O3S2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N-[(E)-(2-nitrophenyl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1ccccc1[N+](=O)[O-])c1ccc(CSc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C22H16N4O3S2/c27-21(25-23-13-17-5-1-3-7-19(17)26(28)29)16-11-9-15(10-12-16)14-30-22-24-18-6-2-4-8-20(18)31-22/h1-13H,14H2,(H,25,27)/b23-13+ |
| InChIKey | WMYHSNPASNUEGA-YDZHTSKRSA-N |
| XLogP | 5.26 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|