C25H25N3OS2 — CID 16556025
N-(2-adamantylideneamino)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzamide (PubChem CID 16556025) has the molecular formula C25H25N3OS2 and a molecular weight of 447.63 g/mol. Its IUPAC name is N-(2-adamantylideneamino)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzamide.
| Compound Name | N-(2-adamantylideneamino)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzamide |
|---|---|
| PubChem CID | 16556025 |
| Molecular Formula | C25H25N3OS2 |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | N-(2-adamantylideneamino)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzamide |
| SMILES | O=C(NN=C1C2CC3CC(C2)CC1C3)c1ccc(CSc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C25H25N3OS2/c29-24(28-27-23-19-10-16-9-17(12-19)13-20(23)11-16)18-7-5-15(6-8-18)14-30-25-26-21-3-1-2-4-22(21)31-25/h1-8,16-17,19-20H,9-14H2,(H,28,29)/b27-23- |
| InChIKey | KPYIKPYIYXJCER-VYIQYICTSA-N |
| XLogP | 6.13 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|