C21H21N3OS2 — CID 2353656
4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N'-(cyclohexen-1-yl)benzohydrazide (PubChem CID 2353656) has the molecular formula C21H21N3OS2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N'-(cyclohexen-1-yl)benzohydrazide.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N'-(cyclohexen-1-yl)benzohydrazide |
|---|---|
| PubChem CID | 2353656 |
| Molecular Formula | C21H21N3OS2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N'-(cyclohexen-1-yl)benzohydrazide |
| SMILES | O=C(NNC1=CCCCC1)c1ccc(CSc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C21H21N3OS2/c25-20(24-23-17-6-2-1-3-7-17)16-12-10-15(11-13-16)14-26-21-22-18-8-4-5-9-19(18)27-21/h4-6,8-13,23H,1-3,7,14H2,(H,24,25) |
| InChIKey | DQNLUVYOPNDKNK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|