C24H21N5O3S2 — CID 24635727
1-[2-[2-[4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzoyl]hydrazinyl]-2-oxoethyl]-3-phenylurea (PubChem CID 24635727) has the molecular formula C24H21N5O3S2 and a molecular weight of 491.60 g/mol. Its IUPAC name is 1-[2-[2-[4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzoyl]hydrazinyl]-2-oxoethyl]-3-phenylurea.
| Compound Name | 1-[2-[2-[4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzoyl]hydrazinyl]-2-oxoethyl]-3-phenylurea |
|---|---|
| PubChem CID | 24635727 |
| Molecular Formula | C24H21N5O3S2 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | 1-[2-[2-[4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzoyl]hydrazinyl]-2-oxoethyl]-3-phenylurea |
| SMILES | O=C(CNC(=O)Nc1ccccc1)NNC(=O)c1ccc(CSc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C24H21N5O3S2/c30-21(14-25-23(32)26-18-6-2-1-3-7-18)28-29-22(31)17-12-10-16(11-13-17)15-33-24-27-19-8-4-5-9-20(19)34-24/h1-13H,14-15H2,(H,28,30)(H,29,31)(H2,25,26,32) |
| InChIKey | XHGOHUKJVFDMDG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 112.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|