C25H20N4O2S2 — CID 25393773
4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N'-[3-(4-cyanophenyl)propanoyl]benzohydrazide (PubChem CID 25393773) has the molecular formula C25H20N4O2S2 and a molecular weight of 472.60 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N'-[3-(4-cyanophenyl)propanoyl]benzohydrazide.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N'-[3-(4-cyanophenyl)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 25393773 |
| Molecular Formula | C25H20N4O2S2 |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N'-[3-(4-cyanophenyl)propanoyl]benzohydrazide |
| SMILES | N#Cc1ccc(CCC(=O)NNC(=O)c2ccc(CSc3nc4ccccc4s3)cc2)cc1 |
| InChI | InChI=1S/C25H20N4O2S2/c26-15-18-7-5-17(6-8-18)11-14-23(30)28-29-24(31)20-12-9-19(10-13-20)16-32-25-27-21-3-1-2-4-22(21)33-25/h1-10,12-13H,11,14,16H2,(H,28,30)(H,29,31) |
| InChIKey | GHRKJZOFYYZKSN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|