C19H16N2O2S2 — CID 7191484
(4-cyanophenyl)methyl 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate (PubChem CID 7191484) has the molecular formula C19H16N2O2S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate.
| Compound Name | (4-cyanophenyl)methyl 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate |
|---|---|
| PubChem CID | 7191484 |
| Molecular Formula | C19H16N2O2S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | (4-cyanophenyl)methyl 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate |
| SMILES | N#Cc1ccc(COC(=O)CCCSc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C19H16N2O2S2/c20-12-14-7-9-15(10-8-14)13-23-18(22)6-3-11-24-19-21-16-4-1-2-5-17(16)25-19/h1-2,4-5,7-10H,3,6,11,13H2 |
| InChIKey | YNPDZNUWIWCLSA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|