C20H19FN2O3S2 — CID 16500311
[2-(3-fluoro-4-methylanilino)-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate (PubChem CID 16500311) has the molecular formula C20H19FN2O3S2 and a molecular weight of 418.52 g/mol. Its IUPAC name is [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate.
| Compound Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate |
|---|---|
| PubChem CID | 16500311 |
| Molecular Formula | C20H19FN2O3S2 |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)CCCSc2nc3ccccc3s2)cc1F |
| InChI | InChI=1S/C20H19FN2O3S2/c1-13-8-9-14(11-15(13)21)22-18(24)12-26-19(25)7-4-10-27-20-23-16-5-2-3-6-17(16)28-20/h2-3,5-6,8-9,11H,4,7,10,12H2,1H3,(H,22,24) |
| InChIKey | IQLLHLABXAGJAS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|