C17H20N2O5S3 — CID 16500323
[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate (PubChem CID 16500323) has the molecular formula C17H20N2O5S3 and a molecular weight of 428.56 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate |
|---|---|
| PubChem CID | 16500323 |
| Molecular Formula | C17H20N2O5S3 |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate |
| SMILES | O=C(COC(=O)CCCSc1nc2ccccc2s1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H20N2O5S3/c20-15(18-12-7-9-27(22,23)11-12)10-24-16(21)6-3-8-25-17-19-13-4-1-2-5-14(13)26-17/h1-2,4-5,12H,3,6-11H2,(H,18,20) |
| InChIKey | RPYKVUSGXBAHND-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|