C17H18N2O7S — CID 3525656
[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 3525656) has the molecular formula C17H18N2O7S and a molecular weight of 394.41 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 3525656 |
| Molecular Formula | C17H18N2O7S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | O=C(COC(=O)CCN1C(=O)c2ccccc2C1=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H18N2O7S/c20-14(18-11-6-8-27(24,25)10-11)9-26-15(21)5-7-19-16(22)12-3-1-2-4-13(12)17(19)23/h1-4,11H,5-10H2,(H,18,20) |
| InChIKey | DVGXAAGRFBOEBV-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|