C15H15N3O7S — CID 18593880
N-(1,1-dioxothiolan-3-yl)-3-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 18593880) has the molecular formula C15H15N3O7S and a molecular weight of 381.37 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 18593880 |
| Molecular Formula | C15H15N3O7S |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | O=C(CCN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H15N3O7S/c19-12(16-9-5-7-26(24,25)8-9)4-6-17-14(20)10-2-1-3-11(18(22)23)13(10)15(17)21/h1-3,9H,4-8H2,(H,16,19) |
| InChIKey | NMMWLBVCEVFLMH-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 143.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|