C11H8N4O6 — CID 2704913
N-carbamoyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 2704913) has the molecular formula C11H8N4O6 and a molecular weight of 292.21 g/mol. Its IUPAC name is N-carbamoyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-carbamoyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 2704913 |
| Molecular Formula | C11H8N4O6 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | N-carbamoyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | NC(=O)NC(=O)CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C11H8N4O6/c12-11(19)13-7(16)4-14-9(17)5-2-1-3-6(15(20)21)8(5)10(14)18/h1-3H,4H2,(H3,12,13,16,19) |
| InChIKey | SBPUJNZPMXXHCL-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 152.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|