C12H9N3O6 — CID 130441943
N-acetyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 130441943) has the molecular formula C12H9N3O6 and a molecular weight of 291.22 g/mol. Its IUPAC name is N-acetyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-acetyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 130441943 |
| Molecular Formula | C12H9N3O6 |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | N-acetyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | CC(=O)NC(=O)CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C12H9N3O6/c1-6(16)13-9(17)5-14-11(18)7-3-2-4-8(15(20)21)10(7)12(14)19/h2-4H,5H2,1H3,(H,13,16,17) |
| InChIKey | HQTUMFREQHZGKX-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|