C12H8N6O5 — CID 845890
2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-(1,2,4-triazol-4-yl)acetamide (PubChem CID 845890) has the molecular formula C12H8N6O5 and a molecular weight of 316.23 g/mol. Its IUPAC name is 2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-(1,2,4-triazol-4-yl)acetamide.
| Compound Name | 2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-(1,2,4-triazol-4-yl)acetamide |
|---|---|
| PubChem CID | 845890 |
| Molecular Formula | C12H8N6O5 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-(1,2,4-triazol-4-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)Nn1cnnc1 |
| InChI | InChI=1S/C12H8N6O5/c19-9(15-16-5-13-14-6-16)4-17-11(20)7-2-1-3-8(18(22)23)10(7)12(17)21/h1-3,5-6H,4H2,(H,15,19) |
| InChIKey | RKZRDMOFMUTKSD-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 140.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|