C12H9N5O3 — CID 830814
2-(1,3-dioxoisoindol-2-yl)-N-(1,2,4-triazol-4-yl)acetamide (PubChem CID 830814) has the molecular formula C12H9N5O3 and a molecular weight of 271.24 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(1,2,4-triazol-4-yl)acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(1,2,4-triazol-4-yl)acetamide |
|---|---|
| PubChem CID | 830814 |
| Molecular Formula | C12H9N5O3 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(1,2,4-triazol-4-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)Nn1cnnc1 |
| InChI | InChI=1S/C12H9N5O3/c18-10(15-16-6-13-14-7-16)5-17-11(19)8-3-1-2-4-9(8)12(17)20/h1-4,6-7H,5H2,(H,15,18) |
| InChIKey | RPPCAVIUBJYFRB-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|