C16H10BrN3O5 — CID 2705011
N-(2-bromophenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 2705011) has the molecular formula C16H10BrN3O5 and a molecular weight of 404.18 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-(2-bromophenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 2705011 |
| Molecular Formula | C16H10BrN3O5 |
| Molecular Weight | 404.18 g/mol |
| Exact Mass | 402.98 |
| IUPAC Name | N-(2-bromophenyl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)Nc1ccccc1Br |
| InChI | InChI=1S/C16H10BrN3O5/c17-10-5-1-2-6-11(10)18-13(21)8-19-15(22)9-4-3-7-12(20(24)25)14(9)16(19)23/h1-7H,8H2,(H,18,21) |
| InChIKey | YGADBJOQIMDGAV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.18 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|