C17H9ClF3N3O5 — CID 18100419
N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 18100419) has the molecular formula C17H9ClF3N3O5 and a molecular weight of 427.72 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 18100419 |
| Molecular Formula | C17H9ClF3N3O5 |
| Molecular Weight | 427.72 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C17H9ClF3N3O5/c18-10-5-4-8(17(19,20)21)6-11(10)22-13(25)7-23-15(26)9-2-1-3-12(24(28)29)14(9)16(23)27/h1-6H,7H2,(H,22,25) |
| InChIKey | LGKWPDBYWSGTBE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.72 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|