C17H11N3O8 — CID 108730224
4-hydroxy-3-[[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]benzoic acid (PubChem CID 108730224) has the molecular formula C17H11N3O8 and a molecular weight of 385.29 g/mol. Its IUPAC name is 4-hydroxy-3-[[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]benzoic acid.
| Compound Name | 4-hydroxy-3-[[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 108730224 |
| Molecular Formula | C17H11N3O8 |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 4-hydroxy-3-[[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]benzoic acid |
| SMILES | O=C(CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)Nc1cc(C(=O)O)ccc1O |
| InChI | InChI=1S/C17H11N3O8/c21-12-5-4-8(17(25)26)6-10(12)18-13(22)7-19-15(23)9-2-1-3-11(20(27)28)14(9)16(19)24/h1-6,21H,7H2,(H,18,22)(H,25,26) |
| InChIKey | KAIDDQSGVKPIQG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 167.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|