C18H13N3O7 — CID 108745382
3-[[[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]methyl]benzoic acid (PubChem CID 108745382) has the molecular formula C18H13N3O7 and a molecular weight of 383.32 g/mol. Its IUPAC name is 3-[[[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]methyl]benzoic acid.
| Compound Name | 3-[[[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 108745382 |
| Molecular Formula | C18H13N3O7 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 3-[[[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]methyl]benzoic acid |
| SMILES | O=C(CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)NCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C18H13N3O7/c22-14(19-8-10-3-1-4-11(7-10)18(25)26)9-20-16(23)12-5-2-6-13(21(27)28)15(12)17(20)24/h1-7H,8-9H2,(H,19,22)(H,25,26) |
| InChIKey | CHGFAPZCPLJTRB-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 146.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|