C20H20N4O8S — CID 108735916
N-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 108735916) has the molecular formula C20H20N4O8S and a molecular weight of 476.47 g/mol. Its IUPAC name is N-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 108735916 |
| Molecular Formula | C20H20N4O8S |
| Molecular Weight | 476.47 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | N-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | COCCNS(=O)(=O)c1ccc(CNC(=O)CN2C(=O)c3cccc([N+](=O)[O-])c3C2=O)cc1 |
| InChI | InChI=1S/C20H20N4O8S/c1-32-10-9-22-33(30,31)14-7-5-13(6-8-14)11-21-17(25)12-23-19(26)15-3-2-4-16(24(28)29)18(15)20(23)27/h2-8,22H,9-12H2,1H3,(H,21,25) |
| InChIKey | QSDIYWTUWZCTRZ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 165.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.47 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|