C23H16FN3O6 — CID 26999144
N-[[4-(4-fluorophenoxy)phenyl]methyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 26999144) has the molecular formula C23H16FN3O6 and a molecular weight of 449.39 g/mol. Its IUPAC name is N-[[4-(4-fluorophenoxy)phenyl]methyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-[[4-(4-fluorophenoxy)phenyl]methyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 26999144 |
| Molecular Formula | C23H16FN3O6 |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | N-[[4-(4-fluorophenoxy)phenyl]methyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)NCc1ccc(Oc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H16FN3O6/c24-15-6-10-17(11-7-15)33-16-8-4-14(5-9-16)12-25-20(28)13-26-22(29)18-2-1-3-19(27(31)32)21(18)23(26)30/h1-11H,12-13H2,(H,25,28) |
| InChIKey | UVEXAOHLMMYKSS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|